C13H17ClN2O4S — CID 110705948
methyl 4-chloro-3-(piperidin-1-ylsulfonylamino)benzoate (PubChem CID 110705948) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is methyl 4-chloro-3-(piperidin-1-ylsulfonylamino)benzoate.
| Compound Name | methyl 4-chloro-3-(piperidin-1-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 110705948 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | methyl 4-chloro-3-(piperidin-1-ylsulfonylamino)benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NS(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C13H17ClN2O4S/c1-20-13(17)10-5-6-11(14)12(9-10)15-21(18,19)16-7-3-2-4-8-16/h5-6,9,15H,2-4,7-8H2,1H3 |
| InChIKey | VIMDTIYYDCDVNZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |