C12H17ClN2O4S — CID 110705880
N-(4-chloro-2,5-dimethoxyphenyl)pyrrolidine-1-sulfonamide (PubChem CID 110705880) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 110705880 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)pyrrolidine-1-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)N2CCCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O4S/c1-18-11-8-10(12(19-2)7-9(11)13)14-20(16,17)15-5-3-4-6-15/h7-8,14H,3-6H2,1-2H3 |
| InChIKey | PXHLJYSQUPYPCE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |