C11H16ClN3O4S2 — CID 61132456
N-(2-chloro-5-sulfamoylphenyl)piperidine-1-sulfonamide (PubChem CID 61132456) has the molecular formula C11H16ClN3O4S2 and a molecular weight of 353.85 g/mol. Its IUPAC name is N-(2-chloro-5-sulfamoylphenyl)piperidine-1-sulfonamide.
| Compound Name | N-(2-chloro-5-sulfamoylphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 61132456 |
| Molecular Formula | C11H16ClN3O4S2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-(2-chloro-5-sulfamoylphenyl)piperidine-1-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(NS(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C11H16ClN3O4S2/c12-10-5-4-9(20(13,16)17)8-11(10)14-21(18,19)15-6-2-1-3-7-15/h4-5,8,14H,1-3,6-7H2,(H2,13,16,17) |
| InChIKey | RHMLYKQQTZILFV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |