C12H19N3O4S2 — CID 61132651
N-(2-methyl-5-sulfamoylphenyl)piperidine-1-sulfonamide (PubChem CID 61132651) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-(2-methyl-5-sulfamoylphenyl)piperidine-1-sulfonamide.
| Compound Name | N-(2-methyl-5-sulfamoylphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 61132651 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-(2-methyl-5-sulfamoylphenyl)piperidine-1-sulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C12H19N3O4S2/c1-10-5-6-11(20(13,16)17)9-12(10)14-21(18,19)15-7-3-2-4-8-15/h5-6,9,14H,2-4,7-8H2,1H3,(H2,13,16,17) |
| InChIKey | RLWKVQAURPPVJW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |