C13H21N3O2S — CID 54880821
N-(3-amino-2,4-dimethylphenyl)piperidine-1-sulfonamide (PubChem CID 54880821) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-(3-amino-2,4-dimethylphenyl)piperidine-1-sulfonamide.
| Compound Name | N-(3-amino-2,4-dimethylphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 54880821 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(3-amino-2,4-dimethylphenyl)piperidine-1-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)N2CCCCC2)c(C)c1N |
| InChI | InChI=1S/C13H21N3O2S/c1-10-6-7-12(11(2)13(10)14)15-19(17,18)16-8-4-3-5-9-16/h6-7,15H,3-5,8-9,14H2,1-2H3 |
| InChIKey | TZUIMZDEJPJCHY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|