C12H19N3O3S — CID 63258793
N-(2-amino-5-methoxyphenyl)piperidine-1-sulfonamide (PubChem CID 63258793) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)piperidine-1-sulfonamide.
| Compound Name | N-(2-amino-5-methoxyphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 63258793 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)piperidine-1-sulfonamide |
| SMILES | COc1ccc(N)c(NS(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C12H19N3O3S/c1-18-10-5-6-11(13)12(9-10)14-19(16,17)15-7-3-2-4-8-15/h5-6,9,14H,2-4,7-8,13H2,1H3 |
| InChIKey | IOGLTIPAXOJSKJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|