C13H20N2O4S — CID 102696009
N-(2-hydroxy-5-methoxyphenyl)-4-methylpiperidine-1-sulfonamide (PubChem CID 102696009) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-(2-hydroxy-5-methoxyphenyl)-4-methylpiperidine-1-sulfonamide.
| Compound Name | N-(2-hydroxy-5-methoxyphenyl)-4-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 102696009 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(2-hydroxy-5-methoxyphenyl)-4-methylpiperidine-1-sulfonamide |
| SMILES | COc1ccc(O)c(NS(=O)(=O)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C13H20N2O4S/c1-10-5-7-15(8-6-10)20(17,18)14-12-9-11(19-2)3-4-13(12)16/h3-4,9-10,14,16H,5-8H2,1-2H3 |
| InChIKey | PAWKEJJCHHDXDT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|