C12H18FN3O2S — CID 63257526
N-(2-amino-5-fluorophenyl)-4-methylpiperidine-1-sulfonamide (PubChem CID 63257526) has the molecular formula C12H18FN3O2S and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-4-methylpiperidine-1-sulfonamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-4-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 63257526 |
| Molecular Formula | C12H18FN3O2S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-4-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)Nc2cc(F)ccc2N)CC1 |
| InChI | InChI=1S/C12H18FN3O2S/c1-9-4-6-16(7-5-9)19(17,18)15-12-8-10(13)2-3-11(12)14/h2-3,8-9,15H,4-7,14H2,1H3 |
| InChIKey | CONGAMLUSCMMQO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|