C10H13IN2O3S — CID 167940813
N-(2-iodo-5-methoxyphenyl)azetidine-1-sulfonamide (PubChem CID 167940813) has the molecular formula C10H13IN2O3S and a molecular weight of 368.20 g/mol. Its IUPAC name is N-(2-iodo-5-methoxyphenyl)azetidine-1-sulfonamide.
| Compound Name | N-(2-iodo-5-methoxyphenyl)azetidine-1-sulfonamide |
|---|---|
| PubChem CID | 167940813 |
| Molecular Formula | C10H13IN2O3S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | N-(2-iodo-5-methoxyphenyl)azetidine-1-sulfonamide |
| SMILES | COc1ccc(I)c(NS(=O)(=O)N2CCC2)c1 |
| InChI | InChI=1S/C10H13IN2O3S/c1-16-8-3-4-9(11)10(7-8)12-17(14,15)13-5-2-6-13/h3-4,7,12H,2,5-6H2,1H3 |
| InChIKey | NAHATIRULCAAKR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|