C10H14N2O4S — CID 154467539
N-(2,5-dihydroxyphenyl)pyrrolidine-1-sulfonamide (PubChem CID 154467539) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is N-(2,5-dihydroxyphenyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(2,5-dihydroxyphenyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 154467539 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | N-(2,5-dihydroxyphenyl)pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(O)ccc1O)N1CCCC1 |
| InChI | InChI=1S/C10H14N2O4S/c13-8-3-4-10(14)9(7-8)11-17(15,16)12-5-1-2-6-12/h3-4,7,11,13-14H,1-2,5-6H2 |
| InChIKey | WZIGADNOPFEVNH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|