C14H23N3O2S — CID 103144757
N-(4-amino-2,5-dimethylphenyl)azepane-1-sulfonamide (PubChem CID 103144757) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethylphenyl)azepane-1-sulfonamide.
| Compound Name | N-(4-amino-2,5-dimethylphenyl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 103144757 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(4-amino-2,5-dimethylphenyl)azepane-1-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)N2CCCCCC2)c(C)cc1N |
| InChI | InChI=1S/C14H23N3O2S/c1-11-10-14(12(2)9-13(11)15)16-20(18,19)17-7-5-3-4-6-8-17/h9-10,16H,3-8,15H2,1-2H3 |
| InChIKey | LTYCCUXCKZLVMX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|