C10H15ClN2O4S2 — CID 63687162
3-(tert-butylsulfonylamino)-4-chlorobenzenesulfonamide (PubChem CID 63687162) has the molecular formula C10H15ClN2O4S2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 3-(tert-butylsulfonylamino)-4-chlorobenzenesulfonamide.
| Compound Name | 3-(tert-butylsulfonylamino)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 63687162 |
| Molecular Formula | C10H15ClN2O4S2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-(tert-butylsulfonylamino)-4-chlorobenzenesulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)Nc1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C10H15ClN2O4S2/c1-10(2,3)19(16,17)13-9-6-7(18(12,14)15)4-5-8(9)11/h4-6,13H,1-3H3,(H2,12,14,15) |
| InChIKey | ZBYYEDQZMGRIKL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |