C18H21ClN2O4 — CID 108972083
methyl 4-chloro-3-[[1-(piperidine-1-carbonyl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 108972083) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is methyl 4-chloro-3-[[1-(piperidine-1-carbonyl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[1-(piperidine-1-carbonyl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 108972083 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | methyl 4-chloro-3-[[1-(piperidine-1-carbonyl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2(C(=O)N3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C18H21ClN2O4/c1-25-15(22)12-5-6-13(19)14(11-12)20-16(23)18(7-8-18)17(24)21-9-3-2-4-10-21/h5-6,11H,2-4,7-10H2,1H3,(H,20,23) |
| InChIKey | SKIXIACPHGWIIZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|