C17H16ClN3O5 — CID 108983551
methyl 4-chloro-3-[[1-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 108983551) has the molecular formula C17H16ClN3O5 and a molecular weight of 377.78 g/mol. Its IUPAC name is methyl 4-chloro-3-[[1-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[1-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 108983551 |
| Molecular Formula | C17H16ClN3O5 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | methyl 4-chloro-3-[[1-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2(C(=O)Nc3cc(C)on3)CC2)c1 |
| InChI | InChI=1S/C17H16ClN3O5/c1-9-7-13(21-26-9)20-16(24)17(5-6-17)15(23)19-12-8-10(14(22)25-2)3-4-11(12)18/h3-4,7-8H,5-6H2,1-2H3,(H,19,23)(H,20,21,24) |
| InChIKey | CRAIKVUHJCEPSA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|