C20H20ClNO3 — CID 100573422
methyl 4-chloro-3-[(1-phenylcyclopentanecarbonyl)amino]benzoate (PubChem CID 100573422) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is methyl 4-chloro-3-[(1-phenylcyclopentanecarbonyl)amino]benzoate.
| Compound Name | methyl 4-chloro-3-[(1-phenylcyclopentanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 100573422 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl 4-chloro-3-[(1-phenylcyclopentanecarbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)C2(c3ccccc3)CCCC2)c1 |
| InChI | InChI=1S/C20H20ClNO3/c1-25-18(23)14-9-10-16(21)17(13-14)22-19(24)20(11-5-6-12-20)15-7-3-2-4-8-15/h2-4,7-10,13H,5-6,11-12H2,1H3,(H,22,24) |
| InChIKey | ITQGWZWPIOOZDJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |