C10H14N2O4S2 — CID 43624381
methyl 3-(pyrrolidin-1-ylsulfonylamino)thiophene-2-carboxylate (PubChem CID 43624381) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is methyl 3-(pyrrolidin-1-ylsulfonylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-(pyrrolidin-1-ylsulfonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43624381 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | methyl 3-(pyrrolidin-1-ylsulfonylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C10H14N2O4S2/c1-16-10(13)9-8(4-7-17-9)11-18(14,15)12-5-2-3-6-12/h4,7,11H,2-3,5-6H2,1H3 |
| InChIKey | IALZWQZVCUQIDW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |