C11H13FN2O5S — CID 63189853
3-fluoro-4-(morpholin-4-ylsulfonylamino)benzoic acid (PubChem CID 63189853) has the molecular formula C11H13FN2O5S and a molecular weight of 304.30 g/mol. Its IUPAC name is 3-fluoro-4-(morpholin-4-ylsulfonylamino)benzoic acid.
| Compound Name | 3-fluoro-4-(morpholin-4-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 63189853 |
| Molecular Formula | C11H13FN2O5S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-fluoro-4-(morpholin-4-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C11H13FN2O5S/c12-9-7-8(11(15)16)1-2-10(9)13-20(17,18)14-3-5-19-6-4-14/h1-2,7,13H,3-6H2,(H,15,16) |
| InChIKey | HDSBSPOQBJANHC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |