C23H22FN3O5S — CID 175830759
3-fluoro-N-[4-hydroxy-3-(morpholin-4-ylsulfonylamino)phenyl]-4-phenylbenzamide (PubChem CID 175830759) has the molecular formula C23H22FN3O5S and a molecular weight of 471.51 g/mol. Its IUPAC name is 3-fluoro-N-[4-hydroxy-3-(morpholin-4-ylsulfonylamino)phenyl]-4-phenylbenzamide.
| Compound Name | 3-fluoro-N-[4-hydroxy-3-(morpholin-4-ylsulfonylamino)phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 175830759 |
| Molecular Formula | C23H22FN3O5S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 3-fluoro-N-[4-hydroxy-3-(morpholin-4-ylsulfonylamino)phenyl]-4-phenylbenzamide |
| SMILES | O=C(Nc1ccc(O)c(NS(=O)(=O)N2CCOCC2)c1)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C23H22FN3O5S/c24-20-14-17(6-8-19(20)16-4-2-1-3-5-16)23(29)25-18-7-9-22(28)21(15-18)26-33(30,31)27-10-12-32-13-11-27/h1-9,14-15,26,28H,10-13H2,(H,25,29) |
| InChIKey | HJHMMMLXOOQZBO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|