C25H18BrFN2O4S — CID 175110326
3-bromo-N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide (PubChem CID 175110326) has the molecular formula C25H18BrFN2O4S and a molecular weight of 541.40 g/mol. Its IUPAC name is 3-bromo-N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide.
| Compound Name | 3-bromo-N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 175110326 |
| Molecular Formula | C25H18BrFN2O4S |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 3-bromo-N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide |
| SMILES | O=C(Nc1ccc(O)c(NS(=O)(=O)c2ccc(F)cc2)c1)c1ccc(-c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C25H18BrFN2O4S/c26-22-14-17(6-12-21(22)16-4-2-1-3-5-16)25(31)28-19-9-13-24(30)23(15-19)29-34(32,33)20-10-7-18(27)8-11-20/h1-15,29-30H,(H,28,31) |
| InChIKey | GHLVXAVMZHAZFL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|