C25H20F2N2O4S — CID 175107999
1-fluoro-N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 175107999) has the molecular formula C25H20F2N2O4S and a molecular weight of 482.51 g/mol. Its IUPAC name is 1-fluoro-N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylcyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 1-fluoro-N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylcyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 175107999 |
| Molecular Formula | C25H20F2N2O4S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 1-fluoro-N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(NS(=O)(=O)c2ccc(F)cc2)c1)C1(F)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C25H20F2N2O4S/c26-19-6-9-21(10-7-19)34(32,33)29-22-16-20(8-11-23(22)30)28-24(31)25(27)14-12-18(13-15-25)17-4-2-1-3-5-17/h1-14,16,29-30H,15H2,(H,28,31) |
| InChIKey | XMVKQBSDGXICHS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|