C10H12ClNO5S — CID 55010075
4-chloro-3-(2-methoxyethylsulfonylamino)benzoic acid (PubChem CID 55010075) has the molecular formula C10H12ClNO5S and a molecular weight of 293.73 g/mol. Its IUPAC name is 4-chloro-3-(2-methoxyethylsulfonylamino)benzoic acid.
| Compound Name | 4-chloro-3-(2-methoxyethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 55010075 |
| Molecular Formula | C10H12ClNO5S |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 4-chloro-3-(2-methoxyethylsulfonylamino)benzoic acid |
| SMILES | COCCS(=O)(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C10H12ClNO5S/c1-17-4-5-18(15,16)12-9-6-7(10(13)14)2-3-8(9)11/h2-3,6,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | LTFJWNDEJIDLER-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |