C10H13ClN2O5S — CID 114814349
4-chloro-3-(2-methoxyethylsulfamoylamino)benzoic acid (PubChem CID 114814349) has the molecular formula C10H13ClN2O5S and a molecular weight of 308.74 g/mol. Its IUPAC name is 4-chloro-3-(2-methoxyethylsulfamoylamino)benzoic acid.
| Compound Name | 4-chloro-3-(2-methoxyethylsulfamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114814349 |
| Molecular Formula | C10H13ClN2O5S |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-chloro-3-(2-methoxyethylsulfamoylamino)benzoic acid |
| SMILES | COCCNS(=O)(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C10H13ClN2O5S/c1-18-5-4-12-19(16,17)13-9-6-7(10(14)15)2-3-8(9)11/h2-3,6,12-13H,4-5H2,1H3,(H,14,15) |
| InChIKey | NLAKOOSIIGIIDQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|