4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid

C10H11F3N2O5S — CID 114806155

IUPAC4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid
SMILESCOc1ccc(C(=O)O)cc1NS(=O)(=O)NCC(F)(F)F
InChIInChI=1S/C10H11F3N2O5S/c1-20-8-3-2-6(9(16)17)4-7(8)15-21(18,19)14-5-10(11,12)13/h2-4,14-15H,5H2,1H3,(H,16,17)
InChIKeyFVPUQRXZALLZPI-UHFFFAOYSA-N
MW328.27 g/mol
LogP1.20
Rot. Bonds6

About 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid

4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid (PubChem CID 114806155) has the molecular formula C10H11F3N2O5S and a molecular weight of 328.27 g/mol. Its IUPAC name is 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid.

Molecular Properties

Compound Name4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid
PubChem CID114806155
Molecular FormulaC10H11F3N2O5S
Molecular Weight328.27 g/mol
Exact Mass328.03
IUPAC Name4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid
SMILESCOc1ccc(C(=O)O)cc1NS(=O)(=O)NCC(F)(F)F
InChIInChI=1S/C10H11F3N2O5S/c1-20-8-3-2-6(9(16)17)4-7(8)15-21(18,19)14-5-10(11,12)13/h2-4,14-15H,5H2,1H3,(H,16,17)
InChIKeyFVPUQRXZALLZPI-UHFFFAOYSA-N
XLogP1.20
TPSA104.73 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.27
LogP ≤ 51.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid?
The IUPAC name of 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid (CID 114806155) is 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid.
What is the SMILES notation for 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid?
The canonical SMILES for 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid is COc1ccc(C(=O)O)cc1NS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid?
The InChIKey is FVPUQRXZALLZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O5S/c1-20-8-3-2-6(9(16)17)4-7(8)15-21(18,19)14-5-10(11,12)13/h2-4,14-15H,5H2,1H3,(H,16,17).
What are the key properties of 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid?
4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid has a molecular weight of 328.27 g/mol, XLogP of 1.20, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid is sourced from PubChem (CID 114806155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).