C10H11F3N2O5S — CID 114806155
4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid (PubChem CID 114806155) has the molecular formula C10H11F3N2O5S and a molecular weight of 328.27 g/mol. Its IUPAC name is 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid.
| Compound Name | 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114806155 |
| Molecular Formula | C10H11F3N2O5S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 4-methoxy-3-(2,2,2-trifluoroethylsulfamoylamino)benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O5S/c1-20-8-3-2-6(9(16)17)4-7(8)15-21(18,19)14-5-10(11,12)13/h2-4,14-15H,5H2,1H3,(H,16,17) |
| InChIKey | FVPUQRXZALLZPI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |