C11H13F3N2O4S — CID 114811459
methyl 5-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)benzoate (PubChem CID 114811459) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is methyl 5-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)benzoate.
| Compound Name | methyl 5-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)benzoate |
|---|---|
| PubChem CID | 114811459 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | methyl 5-methyl-2-(2,2,2-trifluoroethylsulfamoylamino)benzoate |
| SMILES | COC(=O)c1cc(C)ccc1NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O4S/c1-7-3-4-9(8(5-7)10(17)20-2)16-21(18,19)15-6-11(12,13)14/h3-5,15-16H,6H2,1-2H3 |
| InChIKey | UVAJPKQAJJFNTQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |