C14H19NO5S — CID 62047918
methyl 5-methyl-2-(oxan-4-ylsulfonylamino)benzoate (PubChem CID 62047918) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 5-methyl-2-(oxan-4-ylsulfonylamino)benzoate.
| Compound Name | methyl 5-methyl-2-(oxan-4-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 62047918 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl 5-methyl-2-(oxan-4-ylsulfonylamino)benzoate |
| SMILES | COC(=O)c1cc(C)ccc1NS(=O)(=O)C1CCOCC1 |
| InChI | InChI=1S/C14H19NO5S/c1-10-3-4-13(12(9-10)14(16)19-2)15-21(17,18)11-5-7-20-8-6-11/h3-4,9,11,15H,5-8H2,1-2H3 |
| InChIKey | JFXYLEAMGFTQGM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |