C15H17NO3 — CID 64767203
methyl 2-(cyclopent-3-ene-1-carbonylamino)-5-methylbenzoate (PubChem CID 64767203) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 2-(cyclopent-3-ene-1-carbonylamino)-5-methylbenzoate.
| Compound Name | methyl 2-(cyclopent-3-ene-1-carbonylamino)-5-methylbenzoate |
|---|---|
| PubChem CID | 64767203 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | methyl 2-(cyclopent-3-ene-1-carbonylamino)-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)ccc1NC(=O)C1CC=CC1 |
| InChI | InChI=1S/C15H17NO3/c1-10-7-8-13(12(9-10)15(18)19-2)16-14(17)11-5-3-4-6-11/h3-4,7-9,11H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | WKCBGOZTVWQBMQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|