C19H29NO3 — CID 143625975
ethane;methyl 5-methyl-2-[(4-methylcyclohexanecarbonyl)amino]benzoate (PubChem CID 143625975) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is ethane;methyl 5-methyl-2-[(4-methylcyclohexanecarbonyl)amino]benzoate.
| Compound Name | ethane;methyl 5-methyl-2-[(4-methylcyclohexanecarbonyl)amino]benzoate |
|---|---|
| PubChem CID | 143625975 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | ethane;methyl 5-methyl-2-[(4-methylcyclohexanecarbonyl)amino]benzoate |
| SMILES | CC.COC(=O)c1cc(C)ccc1NC(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C17H23NO3.C2H6/c1-11-4-7-13(8-5-11)16(19)18-15-9-6-12(2)10-14(15)17(20)21-3;1-2/h6,9-11,13H,4-5,7-8H2,1-3H3,(H,18,19);1-2H3 |
| InChIKey | PUFPVOPFEGLBKT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |