C13H20N2O5S — CID 63742420
3-[[butyl(methyl)sulfamoyl]amino]-4-methoxybenzoic acid (PubChem CID 63742420) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-[[butyl(methyl)sulfamoyl]amino]-4-methoxybenzoic acid.
| Compound Name | 3-[[butyl(methyl)sulfamoyl]amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 63742420 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-[[butyl(methyl)sulfamoyl]amino]-4-methoxybenzoic acid |
| SMILES | CCCCN(C)S(=O)(=O)Nc1cc(C(=O)O)ccc1OC |
| InChI | InChI=1S/C13H20N2O5S/c1-4-5-8-15(2)21(18,19)14-11-9-10(13(16)17)6-7-12(11)20-3/h6-7,9,14H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | XBRWNJZVJDOLIL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |