C10H16N2O4S2 — CID 43443054
3-[[butyl(methyl)sulfamoyl]amino]thiophene-2-carboxylic acid (PubChem CID 43443054) has the molecular formula C10H16N2O4S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[[butyl(methyl)sulfamoyl]amino]thiophene-2-carboxylic acid.
| Compound Name | 3-[[butyl(methyl)sulfamoyl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43443054 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 3-[[butyl(methyl)sulfamoyl]amino]thiophene-2-carboxylic acid |
| SMILES | CCCCN(C)S(=O)(=O)Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C10H16N2O4S2/c1-3-4-6-12(2)18(15,16)11-8-5-7-17-9(8)10(13)14/h5,7,11H,3-4,6H2,1-2H3,(H,13,14) |
| InChIKey | CENXYPCCAYGCTQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |