C12H16Br2N2O4S — CID 63111857
3,5-dibromo-2-[[butyl(methyl)sulfamoyl]amino]benzoic acid (PubChem CID 63111857) has the molecular formula C12H16Br2N2O4S and a molecular weight of 444.15 g/mol. Its IUPAC name is 3,5-dibromo-2-[[butyl(methyl)sulfamoyl]amino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[[butyl(methyl)sulfamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63111857 |
| Molecular Formula | C12H16Br2N2O4S |
| Molecular Weight | 444.15 g/mol |
| Exact Mass | 441.92 |
| IUPAC Name | 3,5-dibromo-2-[[butyl(methyl)sulfamoyl]amino]benzoic acid |
| SMILES | CCCCN(C)S(=O)(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C12H16Br2N2O4S/c1-3-4-5-16(2)21(19,20)15-11-9(12(17)18)6-8(13)7-10(11)14/h6-7,15H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | UHYAICJHYSFKRP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |