C11H11Br2NO6S — CID 63111808
3,5-dibromo-2-[(3-methoxy-3-oxopropyl)sulfonylamino]benzoic acid (PubChem CID 63111808) has the molecular formula C11H11Br2NO6S and a molecular weight of 445.09 g/mol. Its IUPAC name is 3,5-dibromo-2-[(3-methoxy-3-oxopropyl)sulfonylamino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[(3-methoxy-3-oxopropyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 63111808 |
| Molecular Formula | C11H11Br2NO6S |
| Molecular Weight | 445.09 g/mol |
| Exact Mass | 442.87 |
| IUPAC Name | 3,5-dibromo-2-[(3-methoxy-3-oxopropyl)sulfonylamino]benzoic acid |
| SMILES | COC(=O)CCS(=O)(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C11H11Br2NO6S/c1-20-9(15)2-3-21(18,19)14-10-7(11(16)17)4-6(12)5-8(10)13/h4-5,14H,2-3H2,1H3,(H,16,17) |
| InChIKey | IYQFKIFNWBUAOR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |