C13H17NO6S — CID 63021216
5-[(3-methoxy-3-oxopropyl)sulfonylamino]-2,3-dimethylbenzoic acid (PubChem CID 63021216) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is 5-[(3-methoxy-3-oxopropyl)sulfonylamino]-2,3-dimethylbenzoic acid.
| Compound Name | 5-[(3-methoxy-3-oxopropyl)sulfonylamino]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 63021216 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5-[(3-methoxy-3-oxopropyl)sulfonylamino]-2,3-dimethylbenzoic acid |
| SMILES | COC(=O)CCS(=O)(=O)Nc1cc(C)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H17NO6S/c1-8-6-10(7-11(9(8)2)13(16)17)14-21(18,19)5-4-12(15)20-3/h6-7,14H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | VYTSMZZVRGKCHL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |