C12H15Br2NO5S — CID 79592438
3,5-dibromo-2-(2-propan-2-yloxyethylsulfonylamino)benzoic acid (PubChem CID 79592438) has the molecular formula C12H15Br2NO5S and a molecular weight of 445.13 g/mol. Its IUPAC name is 3,5-dibromo-2-(2-propan-2-yloxyethylsulfonylamino)benzoic acid.
| Compound Name | 3,5-dibromo-2-(2-propan-2-yloxyethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 79592438 |
| Molecular Formula | C12H15Br2NO5S |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 442.90 |
| IUPAC Name | 3,5-dibromo-2-(2-propan-2-yloxyethylsulfonylamino)benzoic acid |
| SMILES | CC(C)OCCS(=O)(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C12H15Br2NO5S/c1-7(2)20-3-4-21(18,19)15-11-9(12(16)17)5-8(13)6-10(11)14/h5-7,15H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | VPLAVWBKITZROY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |