C12H15BrFNO5S — CID 104759163
5-bromo-2-fluoro-3-(2-propan-2-yloxyethylsulfamoyl)benzoic acid (PubChem CID 104759163) has the molecular formula C12H15BrFNO5S and a molecular weight of 384.22 g/mol. Its IUPAC name is 5-bromo-2-fluoro-3-(2-propan-2-yloxyethylsulfamoyl)benzoic acid.
| Compound Name | 5-bromo-2-fluoro-3-(2-propan-2-yloxyethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 104759163 |
| Molecular Formula | C12H15BrFNO5S |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 5-bromo-2-fluoro-3-(2-propan-2-yloxyethylsulfamoyl)benzoic acid |
| SMILES | CC(C)OCCNS(=O)(=O)c1cc(Br)cc(C(=O)O)c1F |
| InChI | InChI=1S/C12H15BrFNO5S/c1-7(2)20-4-3-15-21(18,19)10-6-8(13)5-9(11(10)14)12(16)17/h5-7,15H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | BLXWWHYAISLVLG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|