C10H11Br2NO4S — CID 63111776
3,5-dibromo-2-(propan-2-ylsulfonylamino)benzoic acid (PubChem CID 63111776) has the molecular formula C10H11Br2NO4S and a molecular weight of 401.08 g/mol. Its IUPAC name is 3,5-dibromo-2-(propan-2-ylsulfonylamino)benzoic acid.
| Compound Name | 3,5-dibromo-2-(propan-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 63111776 |
| Molecular Formula | C10H11Br2NO4S |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.88 |
| IUPAC Name | 3,5-dibromo-2-(propan-2-ylsulfonylamino)benzoic acid |
| SMILES | CC(C)S(=O)(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C10H11Br2NO4S/c1-5(2)18(16,17)13-9-7(10(14)15)3-6(11)4-8(9)12/h3-5,13H,1-2H3,(H,14,15) |
| InChIKey | DURCHNLGPKLESF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |