C11H12BrCl2NO4S — CID 61460321
methyl 4-[(4-bromo-2,6-dichlorophenyl)sulfamoyl]butanoate (PubChem CID 61460321) has the molecular formula C11H12BrCl2NO4S and a molecular weight of 405.10 g/mol. Its IUPAC name is methyl 4-[(4-bromo-2,6-dichlorophenyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(4-bromo-2,6-dichlorophenyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 61460321 |
| Molecular Formula | C11H12BrCl2NO4S |
| Molecular Weight | 405.10 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | methyl 4-[(4-bromo-2,6-dichlorophenyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H12BrCl2NO4S/c1-19-10(16)3-2-4-20(17,18)15-11-8(13)5-7(12)6-9(11)14/h5-6,15H,2-4H2,1H3 |
| InChIKey | MUVLFMRNWXCNOW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.10 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |