C12H15ClN2O5S — CID 61460424
methyl 4-[(4-carbamoyl-3-chlorophenyl)sulfamoyl]butanoate (PubChem CID 61460424) has the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. Its IUPAC name is methyl 4-[(4-carbamoyl-3-chlorophenyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(4-carbamoyl-3-chlorophenyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 61460424 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | methyl 4-[(4-carbamoyl-3-chlorophenyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1ccc(C(N)=O)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClN2O5S/c1-20-11(16)3-2-6-21(18,19)15-8-4-5-9(12(14)17)10(13)7-8/h4-5,7,15H,2-3,6H2,1H3,(H2,14,17) |
| InChIKey | UYDIECZGMAQFQD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |