C10H11ClN2O5S — CID 61454806
2-[(4-carbamoyl-3-chlorophenyl)sulfamoyl]propanoic acid (PubChem CID 61454806) has the molecular formula C10H11ClN2O5S and a molecular weight of 306.73 g/mol. Its IUPAC name is 2-[(4-carbamoyl-3-chlorophenyl)sulfamoyl]propanoic acid.
| Compound Name | 2-[(4-carbamoyl-3-chlorophenyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 61454806 |
| Molecular Formula | C10H11ClN2O5S |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-[(4-carbamoyl-3-chlorophenyl)sulfamoyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)Nc1ccc(C(N)=O)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClN2O5S/c1-5(10(15)16)19(17,18)13-6-2-3-7(9(12)14)8(11)4-6/h2-5,13H,1H3,(H2,12,14)(H,15,16) |
| InChIKey | HQHXSHDXOQJZDA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |