C8H10N2O4S — CID 61454432
2-(pyridin-4-ylsulfamoyl)propanoic acid (PubChem CID 61454432) has the molecular formula C8H10N2O4S and a molecular weight of 230.25 g/mol. Its IUPAC name is 2-(pyridin-4-ylsulfamoyl)propanoic acid.
| Compound Name | 2-(pyridin-4-ylsulfamoyl)propanoic acid |
|---|---|
| PubChem CID | 61454432 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-(pyridin-4-ylsulfamoyl)propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)Nc1ccncc1 |
| InChI | InChI=1S/C8H10N2O4S/c1-6(8(11)12)15(13,14)10-7-2-4-9-5-3-7/h2-6H,1H3,(H,9,10)(H,11,12) |
| InChIKey | ZCKYTCVAOFRGLM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |