C13H17NO6S — CID 61454647
2-[(4-propoxycarbonylphenyl)sulfamoyl]propanoic acid (PubChem CID 61454647) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(4-propoxycarbonylphenyl)sulfamoyl]propanoic acid.
| Compound Name | 2-[(4-propoxycarbonylphenyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 61454647 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[(4-propoxycarbonylphenyl)sulfamoyl]propanoic acid |
| SMILES | CCCOC(=O)c1ccc(NS(=O)(=O)C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C13H17NO6S/c1-3-8-20-13(17)10-4-6-11(7-5-10)14-21(18,19)9(2)12(15)16/h4-7,9,14H,3,8H2,1-2H3,(H,15,16) |
| InChIKey | MZDIFYOOBRXANN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |