C13H18N2O5S — CID 61460295
methyl 4-[(4-carbamoyl-2-methylphenyl)sulfamoyl]butanoate (PubChem CID 61460295) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is methyl 4-[(4-carbamoyl-2-methylphenyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(4-carbamoyl-2-methylphenyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 61460295 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | methyl 4-[(4-carbamoyl-2-methylphenyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1ccc(C(N)=O)cc1C |
| InChI | InChI=1S/C13H18N2O5S/c1-9-8-10(13(14)17)5-6-11(9)15-21(18,19)7-3-4-12(16)20-2/h5-6,8,15H,3-4,7H2,1-2H3,(H2,14,17) |
| InChIKey | PVSTXKDKXCTFIV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |