C9H11ClN2O3S — CID 63666829
4-(chloromethylsulfonylamino)-3-methylbenzamide (PubChem CID 63666829) has the molecular formula C9H11ClN2O3S and a molecular weight of 262.72 g/mol. Its IUPAC name is 4-(chloromethylsulfonylamino)-3-methylbenzamide.
| Compound Name | 4-(chloromethylsulfonylamino)-3-methylbenzamide |
|---|---|
| PubChem CID | 63666829 |
| Molecular Formula | C9H11ClN2O3S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 4-(chloromethylsulfonylamino)-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1NS(=O)(=O)CCl |
| InChI | InChI=1S/C9H11ClN2O3S/c1-6-4-7(9(11)13)2-3-8(6)12-16(14,15)5-10/h2-4,12H,5H2,1H3,(H2,11,13) |
| InChIKey | NWXWZVFAXGSYJH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|