C11H12N4O3S — CID 102692470
3-methyl-4-(1H-pyrazol-5-ylsulfonylamino)benzamide (PubChem CID 102692470) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-methyl-4-(1H-pyrazol-5-ylsulfonylamino)benzamide.
| Compound Name | 3-methyl-4-(1H-pyrazol-5-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 102692470 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-methyl-4-(1H-pyrazol-5-ylsulfonylamino)benzamide |
| SMILES | Cc1cc(C(N)=O)ccc1NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C11H12N4O3S/c1-7-6-8(11(12)16)2-3-9(7)15-19(17,18)10-4-5-13-14-10/h2-6,15H,1H3,(H2,12,16)(H,13,14) |
| InChIKey | HBJAMXHPBDRRGE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |