C9H11NO8S2 — CID 54432785
4-methoxy-3-(sulfomethylsulfonylamino)benzoic acid (PubChem CID 54432785) has the molecular formula C9H11NO8S2 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-methoxy-3-(sulfomethylsulfonylamino)benzoic acid.
| Compound Name | 4-methoxy-3-(sulfomethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 54432785 |
| Molecular Formula | C9H11NO8S2 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-methoxy-3-(sulfomethylsulfonylamino)benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NS(=O)(=O)CS(=O)(=O)O |
| InChI | InChI=1S/C9H11NO8S2/c1-18-8-3-2-6(9(11)12)4-7(8)10-19(13,14)5-20(15,16)17/h2-4,10H,5H2,1H3,(H,11,12)(H,15,16,17) |
| InChIKey | WIRDKFGQIQJNQB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|