C11H16N2O5S — CID 84760847
2-[(2-methoxy-5-methylphenyl)sulfamoyl-methylamino]acetic acid (PubChem CID 84760847) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-[(2-methoxy-5-methylphenyl)sulfamoyl-methylamino]acetic acid.
| Compound Name | 2-[(2-methoxy-5-methylphenyl)sulfamoyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 84760847 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[(2-methoxy-5-methylphenyl)sulfamoyl-methylamino]acetic acid |
| SMILES | COc1ccc(C)cc1NS(=O)(=O)N(C)CC(=O)O |
| InChI | InChI=1S/C11H16N2O5S/c1-8-4-5-10(18-3)9(6-8)12-19(16,17)13(2)7-11(14)15/h4-6,12H,7H2,1-3H3,(H,14,15) |
| InChIKey | MCZPXPVOQSYALV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |