C12H16ClNO6S — CID 63290355
5-chloro-2-methoxy-4-(3-methoxypropylsulfonylamino)benzoic acid (PubChem CID 63290355) has the molecular formula C12H16ClNO6S and a molecular weight of 337.78 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-(3-methoxypropylsulfonylamino)benzoic acid.
| Compound Name | 5-chloro-2-methoxy-4-(3-methoxypropylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 63290355 |
| Molecular Formula | C12H16ClNO6S |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 5-chloro-2-methoxy-4-(3-methoxypropylsulfonylamino)benzoic acid |
| SMILES | COCCCS(=O)(=O)Nc1cc(OC)c(C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H16ClNO6S/c1-19-4-3-5-21(17,18)14-10-7-11(20-2)8(12(15)16)6-9(10)13/h6-7,14H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | IEDFCMOCLISYPW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|