C12H17ClN2O5S — CID 61455915
5-chloro-2-methoxy-4-[[methyl(propan-2-yl)sulfamoyl]amino]benzoic acid (PubChem CID 61455915) has the molecular formula C12H17ClN2O5S and a molecular weight of 336.80 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-[[methyl(propan-2-yl)sulfamoyl]amino]benzoic acid.
| Compound Name | 5-chloro-2-methoxy-4-[[methyl(propan-2-yl)sulfamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 61455915 |
| Molecular Formula | C12H17ClN2O5S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5-chloro-2-methoxy-4-[[methyl(propan-2-yl)sulfamoyl]amino]benzoic acid |
| SMILES | COc1cc(NS(=O)(=O)N(C)C(C)C)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H17ClN2O5S/c1-7(2)15(3)21(18,19)14-10-6-11(20-4)8(12(16)17)5-9(10)13/h5-7,14H,1-4H3,(H,16,17) |
| InChIKey | MZEKYZKQPSEJFR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |