C11H14ClNO5S — CID 60860077
5-chloro-2-methoxy-4-(propan-2-ylsulfonylamino)benzoic acid (PubChem CID 60860077) has the molecular formula C11H14ClNO5S and a molecular weight of 307.76 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-(propan-2-ylsulfonylamino)benzoic acid.
| Compound Name | 5-chloro-2-methoxy-4-(propan-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 60860077 |
| Molecular Formula | C11H14ClNO5S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 5-chloro-2-methoxy-4-(propan-2-ylsulfonylamino)benzoic acid |
| SMILES | COc1cc(NS(=O)(=O)C(C)C)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H14ClNO5S/c1-6(2)19(16,17)13-9-5-10(18-3)7(11(14)15)4-8(9)12/h4-6,13H,1-3H3,(H,14,15) |
| InChIKey | YEJINGJGGYGOID-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |