C8H7Cl2NO5S — CID 84760610
5-chloro-4-(chlorosulfonylamino)-2-methoxybenzoic acid (PubChem CID 84760610) has the molecular formula C8H7Cl2NO5S and a molecular weight of 300.12 g/mol. Its IUPAC name is 5-chloro-4-(chlorosulfonylamino)-2-methoxybenzoic acid.
| Compound Name | 5-chloro-4-(chlorosulfonylamino)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 84760610 |
| Molecular Formula | C8H7Cl2NO5S |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 5-chloro-4-(chlorosulfonylamino)-2-methoxybenzoic acid |
| SMILES | COc1cc(NS(=O)(=O)Cl)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C8H7Cl2NO5S/c1-16-7-3-6(11-17(10,14)15)5(9)2-4(7)8(12)13/h2-3,11H,1H3,(H,12,13) |
| InChIKey | ZHTZOVGRRGJSGM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |