C10H11F2NO6S2 — CID 63245135
4,5-difluoro-2-(2-methylsulfonylethylsulfonylamino)benzoic acid (PubChem CID 63245135) has the molecular formula C10H11F2NO6S2 and a molecular weight of 343.33 g/mol. Its IUPAC name is 4,5-difluoro-2-(2-methylsulfonylethylsulfonylamino)benzoic acid.
| Compound Name | 4,5-difluoro-2-(2-methylsulfonylethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 63245135 |
| Molecular Formula | C10H11F2NO6S2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 4,5-difluoro-2-(2-methylsulfonylethylsulfonylamino)benzoic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C10H11F2NO6S2/c1-20(16,17)2-3-21(18,19)13-9-5-8(12)7(11)4-6(9)10(14)15/h4-5,13H,2-3H2,1H3,(H,14,15) |
| InChIKey | VYQHAGIZSKAHOH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |